C13H18O2 — CID 12604022
2-(3,4-dimethylphenyl)-3-methylbutanoic acid (PubChem CID 12604022) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-3-methylbutanoic acid.
| Compound Name | 2-(3,4-dimethylphenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 12604022 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-3-methylbutanoic acid |
| SMILES | Cc1ccc(C(C(=O)O)C(C)C)cc1C |
| InChI | InChI=1S/C13H18O2/c1-8(2)12(13(14)15)11-6-5-9(3)10(4)7-11/h5-8,12H,1-4H3,(H,14,15) |
| InChIKey | HMSRRWVXWSUPLW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |