C42H35ClN4O6S — CID 126042079
ethyl (2E,5R)-5-(5-chloro-2-methoxyphenyl)-2-[[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-3-oxo-7-propyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126042079) has the molecular formula C42H35ClN4O6S and a molecular weight of 759.28 g/mol. Its IUPAC name is ethyl (2E,5R)-5-(5-chloro-2-methoxyphenyl)-2-[[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-3-oxo-7-propyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5R)-5-(5-chloro-2-methoxyphenyl)-2-[[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-3-oxo-7-propyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126042079 |
| Molecular Formula | C42H35ClN4O6S |
| Molecular Weight | 759.28 g/mol |
| Exact Mass | 758.20 |
| IUPAC Name | ethyl (2E,5R)-5-(5-chloro-2-methoxyphenyl)-2-[[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-3-oxo-7-propyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCCC1=C(C(=O)OCC)[C@@H](c2cc(Cl)ccc2OC)n2c(s/c(=C/c3cc(-c4ccccc4)n(-c4ccc([N+](=O)[O-])cc4)c3-c3ccccc3)c2=O)=N1 |
| InChI | InChI=1S/C42H35ClN4O6S/c1-4-12-33-37(41(49)53-5-2)39(32-25-29(43)17-22-35(32)52-3)46-40(48)36(54-42(46)44-33)24-28-23-34(26-13-8-6-9-14-26)45(38(28)27-15-10-7-11-16-27)30-18-20-31(21-19-30)47(50)51/h6-11,13-25,39H,4-5,12H2,1-3H3/b36-24+/t39-/m1/s1 |
| InChIKey | JWEBZVNONHUALB-FSIJRYPJSA-N |
| XLogP | 8.27 |
| TPSA | 117.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.28 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|