C18H14N4O6 — CID 126044737
(1S,2R,6R,7S,8R,10R)-4-[(Z)-(3,5-dinitrophenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 126044737) has the molecular formula C18H14N4O6 and a molecular weight of 382.33 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,10R)-4-[(Z)-(3,5-dinitrophenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S,8R,10R)-4-[(Z)-(3,5-dinitrophenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 126044737 |
| Molecular Formula | C18H14N4O6 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | (1S,2R,6R,7S,8R,10R)-4-[(Z)-(3,5-dinitrophenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@@H]34)[C@H]2C(=O)N1/N=C\c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N4O6/c23-17-15-11-1-2-12(14-6-13(11)14)16(15)18(24)20(17)19-7-8-3-9(21(25)26)5-10(4-8)22(27)28/h1-5,7,11-16H,6H2/b19-7-/t11-,12-,13-,14-,15+,16+/m0/s1 |
| InChIKey | FEHKZRPFQIVTPM-VQVYUXSPSA-N |
| XLogP | 1.89 |
| TPSA | 136.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|