C27H24N4O7 — CID 126045581
[2-[(E)-3-[2-[4-(2-methylpropanoylamino)benzoyl]hydrazinyl]-3-oxoprop-1-enyl]phenyl] 4-nitrobenzoate (PubChem CID 126045581) has the molecular formula C27H24N4O7 and a molecular weight of 516.51 g/mol. Its IUPAC name is [2-[(E)-3-[2-[4-(2-methylpropanoylamino)benzoyl]hydrazinyl]-3-oxoprop-1-enyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2-[(E)-3-[2-[4-(2-methylpropanoylamino)benzoyl]hydrazinyl]-3-oxoprop-1-enyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126045581 |
| Molecular Formula | C27H24N4O7 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | [2-[(E)-3-[2-[4-(2-methylpropanoylamino)benzoyl]hydrazinyl]-3-oxoprop-1-enyl]phenyl] 4-nitrobenzoate |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)NNC(=O)/C=C/c2ccccc2OC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H24N4O7/c1-17(2)25(33)28-21-12-7-19(8-13-21)26(34)30-29-24(32)16-11-18-5-3-4-6-23(18)38-27(35)20-9-14-22(15-10-20)31(36)37/h3-17H,1-2H3,(H,28,33)(H,29,32)(H,30,34)/b16-11+ |
| InChIKey | WLMSQCUIXRQSTJ-LFIBNONCSA-N |
| XLogP | 3.88 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|