C15H15I2NO2S2 — CID 126046466
(5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-3-(2-methylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126046466) has the molecular formula C15H15I2NO2S2 and a molecular weight of 559.23 g/mol. Its IUPAC name is (5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-3-(2-methylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-3-(2-methylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126046466 |
| Molecular Formula | C15H15I2NO2S2 |
| Molecular Weight | 559.23 g/mol |
| Exact Mass | 558.86 |
| IUPAC Name | (5Z)-5-[(3,5-diiodo-2-methoxyphenyl)methylidene]-3-(2-methylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1c(I)cc(I)cc1/C=C1\SC(=S)N(CC(C)C)C1=O |
| InChI | InChI=1S/C15H15I2NO2S2/c1-8(2)7-18-14(19)12(22-15(18)21)5-9-4-10(16)6-11(17)13(9)20-3/h4-6,8H,7H2,1-3H3/b12-5- |
| InChIKey | XKZMOTQIWURJET-XGICHPGQSA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|