C28H23N3O7S — CID 126046804
methyl (2E,5R)-7-ethyl-2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126046804) has the molecular formula C28H23N3O7S and a molecular weight of 545.57 g/mol. Its IUPAC name is methyl (2E,5R)-7-ethyl-2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (2E,5R)-7-ethyl-2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126046804 |
| Molecular Formula | C28H23N3O7S |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | methyl (2E,5R)-7-ethyl-2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCC1=C(C(=O)OC)[C@@H](c2ccccc2)n2c(s/c(=C/c3ccc(-c4ccc(OC)cc4[N+](=O)[O-])o3)c2=O)=N1 |
| InChI | InChI=1S/C28H23N3O7S/c1-4-20-24(27(33)37-3)25(16-8-6-5-7-9-16)30-26(32)23(39-28(30)29-20)15-18-11-13-22(38-18)19-12-10-17(36-2)14-21(19)31(34)35/h5-15,25H,4H2,1-3H3/b23-15+/t25-/m1/s1 |
| InChIKey | TYSVYJDJKJROIJ-XSZPGNIMSA-N |
| XLogP | 3.98 |
| TPSA | 126.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|