C13H19NO2 — CID 12604735
3-methylspiro[1,3-oxazolidine-5,2'-adamantane]-2-one (PubChem CID 12604735) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-methylspiro[1,3-oxazolidine-5,2'-adamantane]-2-one.
| Compound Name | 3-methylspiro[1,3-oxazolidine-5,2'-adamantane]-2-one |
|---|---|
| PubChem CID | 12604735 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-methylspiro[1,3-oxazolidine-5,2'-adamantane]-2-one |
| SMILES | CN1CC2(OC1=O)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C13H19NO2/c1-14-7-13(16-12(14)15)10-3-8-2-9(5-10)6-11(13)4-8/h8-11H,2-7H2,1H3 |
| InChIKey | UDZTZAZTIIKKDO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |