C26H21Cl2N3O2S — CID 126048467
(2Z)-2-[[1-[(2,4-dichlorophenyl)methyl]-2,7-dimethylindol-3-yl]methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione (PubChem CID 126048467) has the molecular formula C26H21Cl2N3O2S and a molecular weight of 510.45 g/mol. Its IUPAC name is (2Z)-2-[[1-[(2,4-dichlorophenyl)methyl]-2,7-dimethylindol-3-yl]methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione.
| Compound Name | (2Z)-2-[[1-[(2,4-dichlorophenyl)methyl]-2,7-dimethylindol-3-yl]methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione |
|---|---|
| PubChem CID | 126048467 |
| Molecular Formula | C26H21Cl2N3O2S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | (2Z)-2-[[1-[(2,4-dichlorophenyl)methyl]-2,7-dimethylindol-3-yl]methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione |
| SMILES | Cc1nc2s/c(=C\c3c(C)n(Cc4ccc(Cl)cc4Cl)c4c(C)cccc34)c(=O)n2c(=O)c1C |
| InChI | InChI=1S/C26H21Cl2N3O2S/c1-13-6-5-7-19-20(11-22-25(33)31-24(32)14(2)15(3)29-26(31)34-22)16(4)30(23(13)19)12-17-8-9-18(27)10-21(17)28/h5-11H,12H2,1-4H3/b22-11- |
| InChIKey | BBLFYTXEYZSINR-JJFYIABZSA-N |
| XLogP | 5.21 |
| TPSA | 56.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |