C28H20Cl2F3N3O — CID 126049696
(4E)-4-[[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylidene]-5-methyl-2-(2,4,5-trifluorophenyl)pyrazol-3-one (PubChem CID 126049696) has the molecular formula C28H20Cl2F3N3O and a molecular weight of 542.39 g/mol. Its IUPAC name is (4E)-4-[[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylidene]-5-methyl-2-(2,4,5-trifluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylidene]-5-methyl-2-(2,4,5-trifluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126049696 |
| Molecular Formula | C28H20Cl2F3N3O |
| Molecular Weight | 542.39 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | (4E)-4-[[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylidene]-5-methyl-2-(2,4,5-trifluorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2cc(F)c(F)cc2F)C(=O)/C1=C/c1c(C)n(Cc2ccc(Cl)c(Cl)c2)c2ccc(C)cc12 |
| InChI | InChI=1S/C28H20Cl2F3N3O/c1-14-4-7-26-20(8-14)19(16(3)35(26)13-17-5-6-21(29)22(30)9-17)10-18-15(2)34-36(28(18)37)27-12-24(32)23(31)11-25(27)33/h4-12H,13H2,1-3H3/b18-10+ |
| InChIKey | DPKXTHVIIQZUAU-VCHYOVAHSA-N |
| XLogP | 7.84 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.39 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|