C20H12Br2ClNO3S — CID 126051428
(5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione (PubChem CID 126051428) has the molecular formula C20H12Br2ClNO3S and a molecular weight of 541.65 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126051428 |
| Molecular Formula | C20H12Br2ClNO3S |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 538.86 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCN1C(=O)S/C(=C/c2cc(Br)c(OCc3ccc(Cl)cc3)c(Br)c2)C1=O |
| InChI | InChI=1S/C20H12Br2ClNO3S/c1-2-7-24-19(25)17(28-20(24)26)10-13-8-15(21)18(16(22)9-13)27-11-12-3-5-14(23)6-4-12/h1,3-6,8-10H,7,11H2/b17-10+ |
| InChIKey | XFZVFRXKSBJIJO-LICLKQGHSA-N |
| XLogP | 6.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|