About N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine
N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine (PubChem CID 126051547) has the molecular formula C17H13BrN2OS2
and a molecular weight of 405.34 g/mol. Its IUPAC name is N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine.
Molecular Properties
| Compound Name | N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine |
| PubChem CID | 126051547 |
| Molecular Formula | C17H13BrN2OS2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine |
| SMILES | COc1ccc(Br)c2c1-c1nc(N=Cc3sccc3C)sc1C2 |
| InChI | InChI=1S/C17H13BrN2OS2/c1-9-5-6-22-14(9)8-19-17-20-16-13(23-17)7-10-11(18)3-4-12(21-2)15(10)16/h3-6,8H,7H2,1-2H3 |
| InChIKey | FEGLZFDTEHTZKZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine?
The IUPAC name of N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine (CID 126051547) is N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine.
What is the SMILES notation for N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine?
The canonical SMILES for N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine is COc1ccc(Br)c2c1-c1nc(N=Cc3sccc3C)sc1C2.
What is the InChIKey of N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine?
The InChIKey is FEGLZFDTEHTZKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrN2OS2/c1-9-5-6-22-14(9)8-19-17-20-16-13(23-17)7-10-11(18)3-4-12(21-2)15(10)16/h3-6,8H,7H2,1-2H3.
What are the key properties of N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine?
N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine has a molecular weight of 405.34 g/mol, XLogP of 5.61, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-methylthiophen-2-yl)methanimine is sourced from PubChem (CID 126051547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).