C25H16Cl3FN2O4 — CID 126055986
(5E)-1-(3-chloro-2-methylphenyl)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126055986) has the molecular formula C25H16Cl3FN2O4 and a molecular weight of 533.77 g/mol. Its IUPAC name is (5E)-1-(3-chloro-2-methylphenyl)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(3-chloro-2-methylphenyl)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126055986 |
| Molecular Formula | C25H16Cl3FN2O4 |
| Molecular Weight | 533.77 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | (5E)-1-(3-chloro-2-methylphenyl)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1c(Cl)cccc1N1C(=O)NC(=O)/C(=C\c2cc(Cl)c(OCc3ccccc3F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C25H16Cl3FN2O4/c1-13-17(26)6-4-8-21(13)31-24(33)16(23(32)30-25(31)34)9-14-10-18(27)22(19(28)11-14)35-12-15-5-2-3-7-20(15)29/h2-11H,12H2,1H3,(H,30,32,34)/b16-9+ |
| InChIKey | WQLLALFUZSRWLF-CXUHLZMHSA-N |
| XLogP | 6.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.77 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|