About (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline
(11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline (PubChem CID 1260563) has the molecular formula C23H16N2
and a molecular weight of 320.39 g/mol. Its IUPAC name is (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline.
Molecular Properties
| Compound Name | (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline |
| PubChem CID | 1260563 |
| Molecular Formula | C23H16N2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline |
| SMILES | Cc1ccc2c(c1)/C(=C/c1ccncc1)c1cc3ccccc3nc1-2 |
| InChI | InChI=1S/C23H16N2/c1-15-6-7-18-19(12-15)20(13-16-8-10-24-11-9-16)21-14-17-4-2-3-5-22(17)25-23(18)21/h2-14H,1H3/b20-13- |
| InChIKey | KWLJNVDYSGKUTI-MOSHPQCFSA-N |
| XLogP | 5.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline?
The IUPAC name of (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline (CID 1260563) is (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline.
What is the SMILES notation for (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline?
The canonical SMILES for (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline is Cc1ccc2c(c1)/C(=C/c1ccncc1)c1cc3ccccc3nc1-2.
What is the InChIKey of (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline?
The InChIKey is KWLJNVDYSGKUTI-MOSHPQCFSA-N. The full InChI is InChI=1S/C23H16N2/c1-15-6-7-18-19(12-15)20(13-16-8-10-24-11-9-16)21-14-17-4-2-3-5-22(17)25-23(18)21/h2-14H,1H3/b20-13-.
What are the key properties of (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline?
(11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline has a molecular weight of 320.39 g/mol, XLogP of 5.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (11Z)-2-methyl-11-(pyridin-4-ylmethylidene)indeno[1,2-b]quinoline is sourced from PubChem (CID 1260563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).