C25H19BrClN3O3 — CID 126056810
(E)-3-[5-bromo-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 126056810) has the molecular formula C25H19BrClN3O3 and a molecular weight of 524.80 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[5-bromo-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126056810 |
| Molecular Formula | C25H19BrClN3O3 |
| Molecular Weight | 524.80 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | (E)-3-[5-bromo-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-N-(2-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(Br)cc2/C=C(\C#N)C(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C25H19BrClN3O3/c1-16-5-4-6-20(11-16)29-24(31)15-33-23-10-9-19(26)13-17(23)12-18(14-28)25(32)30-22-8-3-2-7-21(22)27/h2-13H,15H2,1H3,(H,29,31)(H,30,32)/b18-12+ |
| InChIKey | VIHXHAZFFRPMOQ-LDADJPATSA-N |
| XLogP | 5.97 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.80 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|