C19H16BrClN2O3 — CID 126057291
N-[(Z)-(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-2-chloro-4-methylbenzamide (PubChem CID 126057291) has the molecular formula C19H16BrClN2O3 and a molecular weight of 435.71 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-2-chloro-4-methylbenzamide.
| Compound Name | N-[(Z)-(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-2-chloro-4-methylbenzamide |
|---|---|
| PubChem CID | 126057291 |
| Molecular Formula | C19H16BrClN2O3 |
| Molecular Weight | 435.71 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | N-[(Z)-(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-2-chloro-4-methylbenzamide |
| SMILES | C#CCOc1c(Br)cc(/C=N\NC(=O)c2ccc(C)cc2Cl)cc1OC |
| InChI | InChI=1S/C19H16BrClN2O3/c1-4-7-26-18-15(20)9-13(10-17(18)25-3)11-22-23-19(24)14-6-5-12(2)8-16(14)21/h1,5-6,8-11H,7H2,2-3H3,(H,23,24)/b22-11- |
| InChIKey | BVBRCLVBVCHUAV-JJFYIABZSA-N |
| XLogP | 4.20 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.71 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|