About 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine
3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 126058344) has the molecular formula C24H17ClN4
and a molecular weight of 396.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 126058344 |
| Molecular Formula | C24H17ClN4 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Nc1c(-c2ccccc2)cnc2c(-c3ccc(Cl)cc3)c(-c3ccccc3)nn12 |
| InChI | InChI=1S/C24H17ClN4/c25-19-13-11-17(12-14-19)21-22(18-9-5-2-6-10-18)28-29-23(26)20(15-27-24(21)29)16-7-3-1-4-8-16/h1-15H,26H2 |
| InChIKey | FFWDGEVKOKNELW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine (CID 126058344) is 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine is Nc1c(-c2ccccc2)cnc2c(-c3ccc(Cl)cc3)c(-c3ccccc3)nn12.
What is the InChIKey of 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is FFWDGEVKOKNELW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17ClN4/c25-19-13-11-17(12-14-19)21-22(18-9-5-2-6-10-18)28-29-23(26)20(15-27-24(21)29)16-7-3-1-4-8-16/h1-15H,26H2.
What are the key properties of 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine?
3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 396.88 g/mol, XLogP of 5.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-2,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 126058344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).