C26H26N3O4+ — CID 126059360
N-[(1Z,4R,5S)-1-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methylbenzamide (PubChem CID 126059360) has the molecular formula C26H26N3O4+ and a molecular weight of 444.51 g/mol. Its IUPAC name is N-[(1Z,4R,5S)-1-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methylbenzamide.
| Compound Name | N-[(1Z,4R,5S)-1-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 126059360 |
| Molecular Formula | C26H26N3O4+ |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[(1Z,4R,5S)-1-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methylbenzamide |
| SMILES | COc1ccc(/C=[N+]2\NC(=O)[C@H](NC(=O)c3ccc(C)cc3)[C@@H]2c2ccccc2)cc1OC |
| InChI | InChI=1S/C26H25N3O4/c1-17-9-12-20(13-10-17)25(30)27-23-24(19-7-5-4-6-8-19)29(28-26(23)31)16-18-11-14-21(32-2)22(15-18)33-3/h4-16,23-24H,1-3H3,(H-,27,28,30,31)/p+1/b29-16-/t23-,24+/m1/s1 |
| InChIKey | FPNTXJXMXDMNQL-GZUHYISBSA-O |
| XLogP | 3.03 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|