About (2-fluorophenyl)urea
(2-fluorophenyl)urea (PubChem CID 12606) has the molecular formula C7H7FN2O
and a molecular weight of 154.14 g/mol. Its IUPAC name is (2-fluorophenyl)urea.
Molecular Properties
| Compound Name | (2-fluorophenyl)urea |
| PubChem CID | 12606 |
| Molecular Formula | C7H7FN2O |
| Molecular Weight | 154.14 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | (2-fluorophenyl)urea |
| SMILES | NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C7H7FN2O/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| InChIKey | PAWVOCWEWJXILY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-fluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)urea?
The IUPAC name of (2-fluorophenyl)urea (CID 12606) is (2-fluorophenyl)urea.
What is the SMILES notation for (2-fluorophenyl)urea?
The canonical SMILES for (2-fluorophenyl)urea is NC(=O)Nc1ccccc1F.
What is the InChIKey of (2-fluorophenyl)urea?
The InChIKey is PAWVOCWEWJXILY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2O/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11).
What are the key properties of (2-fluorophenyl)urea?
(2-fluorophenyl)urea has a molecular weight of 154.14 g/mol, XLogP of 1.32, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)urea is sourced from PubChem (CID 12606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).