C17H17N3O3 — CID 126061360
4-methoxy-N-[(4S,5S)-3-oxo-5-phenylpyrazolidin-4-yl]benzamide (PubChem CID 126061360) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 4-methoxy-N-[(4S,5S)-3-oxo-5-phenylpyrazolidin-4-yl]benzamide.
| Compound Name | 4-methoxy-N-[(4S,5S)-3-oxo-5-phenylpyrazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 126061360 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-methoxy-N-[(4S,5S)-3-oxo-5-phenylpyrazolidin-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2C(=O)NN[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H17N3O3/c1-23-13-9-7-12(8-10-13)16(21)18-15-14(19-20-17(15)22)11-5-3-2-4-6-11/h2-10,14-15,19H,1H3,(H,18,21)(H,20,22)/t14-,15-/m0/s1 |
| InChIKey | OSIVNDFHYFCOIS-GJZGRUSLSA-N |
| XLogP | 1.17 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |