C14H13F6N3O2 — CID 12606474
3-imino-5,6-bis(2,2,2-trifluoroethoxymethyl)isoindol-1-amine (PubChem CID 12606474) has the molecular formula C14H13F6N3O2 and a molecular weight of 369.27 g/mol. Its IUPAC name is 3-imino-5,6-bis(2,2,2-trifluoroethoxymethyl)isoindol-1-amine.
| Compound Name | 3-imino-5,6-bis(2,2,2-trifluoroethoxymethyl)isoindol-1-amine |
|---|---|
| PubChem CID | 12606474 |
| Molecular Formula | C14H13F6N3O2 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 3-imino-5,6-bis(2,2,2-trifluoroethoxymethyl)isoindol-1-amine |
| SMILES | [H]/N=C1\N=C(N)c2cc(COCC(F)(F)F)c(COCC(F)(F)F)cc21 |
| InChI | InChI=1S/C14H13F6N3O2/c15-13(16,17)5-24-3-7-1-9-10(12(22)23-11(9)21)2-8(7)4-25-6-14(18,19)20/h1-2H,3-6H2,(H3,21,22,23) |
| InChIKey | FKIKOWAMHMSADE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|