C29H30N2O4 — CID 126065360
methyl (4Z)-4-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-1-(4-ethoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126065360) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is methyl (4Z)-4-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-1-(4-ethoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-4-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-1-(4-ethoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126065360 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | methyl (4Z)-4-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-1-(4-ethoxyphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCOc1ccc(N2C(=O)/C(=C\c3cc(C)n(-c4cccc(C)c4)c3C)C(C(=O)OC)=C2C)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-7-35-25-13-11-23(12-14-25)31-21(5)27(29(33)34-6)26(28(31)32)17-22-16-19(3)30(20(22)4)24-10-8-9-18(2)15-24/h8-17H,7H2,1-6H3/b26-17- |
| InChIKey | PXGQXLVOPXUQCD-ONUIUJJFSA-N |
| XLogP | 5.68 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|