C25H24N3O3+ — CID 126065825
N-[(1Z,4S,5R)-1-[(4-methoxyphenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide (PubChem CID 126065825) has the molecular formula C25H24N3O3+ and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[(1Z,4S,5R)-1-[(4-methoxyphenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide.
| Compound Name | N-[(1Z,4S,5R)-1-[(4-methoxyphenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126065825 |
| Molecular Formula | C25H24N3O3+ |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[(1Z,4S,5R)-1-[(4-methoxyphenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide |
| SMILES | COc1ccc(/C=[N+]2\NC(=O)[C@@H](NC(=O)c3cccc(C)c3)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-17-7-6-10-20(15-17)24(29)26-22-23(19-8-4-3-5-9-19)28(27-25(22)30)16-18-11-13-21(31-2)14-12-18/h3-16,22-23H,1-2H3,(H-,26,27,29,30)/p+1/b28-16-/t22-,23+/m0/s1 |
| InChIKey | NFZLFGAHROXXHS-HFXBMHRVSA-O |
| XLogP | 3.02 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|