C26H21Cl2NO5S — CID 126066346
(5Z)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-(2-methoxyphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126066346) has the molecular formula C26H21Cl2NO5S and a molecular weight of 530.43 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-(2-methoxyphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-(2-methoxyphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126066346 |
| Molecular Formula | C26H21Cl2NO5S |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | (5Z)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-(2-methoxyphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(c3ccccc3OC)C2=O)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H21Cl2NO5S/c1-3-33-22-13-17(12-19(28)24(22)34-15-16-8-10-18(27)11-9-16)14-23-25(30)29(26(31)35-23)20-6-4-5-7-21(20)32-2/h4-14H,3,15H2,1-2H3/b23-14- |
| InChIKey | STFHGUWSBXRICX-UCQKPKSFSA-N |
| XLogP | 7.22 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|