C24H21ClN3O3+ — CID 126067465
N-[(1Z,4R,5R)-1-[(4-chlorophenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]benzamide (PubChem CID 126067465) has the molecular formula C24H21ClN3O3+ and a molecular weight of 434.90 g/mol. Its IUPAC name is N-[(1Z,4R,5R)-1-[(4-chlorophenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]benzamide.
| Compound Name | N-[(1Z,4R,5R)-1-[(4-chlorophenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]benzamide |
|---|---|
| PubChem CID | 126067465 |
| Molecular Formula | C24H21ClN3O3+ |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[(1Z,4R,5R)-1-[(4-chlorophenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]benzamide |
| SMILES | COc1ccc([C@@H]2[C@@H](NC(=O)c3ccccc3)C(=O)N/[N+]2=C\c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H20ClN3O3/c1-31-20-13-9-17(10-14-20)22-21(26-23(29)18-5-3-2-4-6-18)24(30)27-28(22)15-16-7-11-19(25)12-8-16/h2-15,21-22H,1H3,(H-,26,27,29,30)/p+1/b28-15-/t21-,22-/m1/s1 |
| InChIKey | UVDIDFHIYSQBGE-KSYIGNPDSA-O |
| XLogP | 3.36 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|