C18H15ClN2O3S2 — CID 126067738
methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[(5-methylthiophen-2-yl)methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 126067738) has the molecular formula C18H15ClN2O3S2 and a molecular weight of 406.92 g/mol. Its IUPAC name is methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[(5-methylthiophen-2-yl)methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[(5-methylthiophen-2-yl)methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 126067738 |
| Molecular Formula | C18H15ClN2O3S2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[(5-methylthiophen-2-yl)methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=S)N(c2ccc(Cl)cc2)C(=O)/C1=C/c1ccc(C)s1 |
| InChI | InChI=1S/C18H15ClN2O3S2/c1-11-3-8-14(26-11)9-15-17(23)21(13-6-4-12(19)5-7-13)18(25)20(15)10-16(22)24-2/h3-9H,10H2,1-2H3/b15-9- |
| InChIKey | DGYXJPZEWYUCIH-DHDCSXOGSA-N |
| XLogP | 3.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|