C29H29ClN2O4 — CID 126067812
methyl (4Z)-1-(3-chloro-4-methoxyphenyl)-4-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126067812) has the molecular formula C29H29ClN2O4 and a molecular weight of 505.01 g/mol. Its IUPAC name is methyl (4Z)-1-(3-chloro-4-methoxyphenyl)-4-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-1-(3-chloro-4-methoxyphenyl)-4-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126067812 |
| Molecular Formula | C29H29ClN2O4 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | methyl (4Z)-1-(3-chloro-4-methoxyphenyl)-4-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(OC)c(Cl)c2)C(=O)/C1=C\c1cc(C)n(-c2cc(C)cc(C)c2)c1C |
| InChI | InChI=1S/C29H29ClN2O4/c1-16-10-17(2)12-23(11-16)31-18(3)13-21(19(31)4)14-24-27(29(34)36-7)20(5)32(28(24)33)22-8-9-26(35-6)25(30)15-22/h8-15H,1-7H3/b24-14- |
| InChIKey | XAUUIQLIKKGBPJ-OYKKKHCWSA-N |
| XLogP | 6.25 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|