About N-benzyl-N,2,2-trimethylpropanamide
N-benzyl-N,2,2-trimethylpropanamide (PubChem CID 12606821) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is N-benzyl-N,2,2-trimethylpropanamide.
Molecular Properties
| Compound Name | N-benzyl-N,2,2-trimethylpropanamide |
| PubChem CID | 12606821 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-benzyl-N,2,2-trimethylpropanamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C13H19NO/c1-13(2,3)12(15)14(4)10-11-8-6-5-7-9-11/h5-9H,10H2,1-4H3 |
| InChIKey | DAAJIFSPEAZXKE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-N,2,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N,2,2-trimethylpropanamide?
The IUPAC name of N-benzyl-N,2,2-trimethylpropanamide (CID 12606821) is N-benzyl-N,2,2-trimethylpropanamide.
What is the SMILES notation for N-benzyl-N,2,2-trimethylpropanamide?
The canonical SMILES for N-benzyl-N,2,2-trimethylpropanamide is CN(Cc1ccccc1)C(=O)C(C)(C)C.
What is the InChIKey of N-benzyl-N,2,2-trimethylpropanamide?
The InChIKey is DAAJIFSPEAZXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-13(2,3)12(15)14(4)10-11-8-6-5-7-9-11/h5-9H,10H2,1-4H3.
What are the key properties of N-benzyl-N,2,2-trimethylpropanamide?
N-benzyl-N,2,2-trimethylpropanamide has a molecular weight of 205.30 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N,2,2-trimethylpropanamide is sourced from PubChem (CID 12606821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).