About morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone
morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone (PubChem CID 12606981) has the molecular formula C10H11N5O2
and a molecular weight of 233.23 g/mol. Its IUPAC name is morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone.
Molecular Properties
| Compound Name | morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone |
| PubChem CID | 12606981 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone |
| SMILES | O=C(c1nnc2cccnn12)N1CCOCC1 |
| InChI | InChI=1S/C10H11N5O2/c16-10(14-4-6-17-7-5-14)9-13-12-8-2-1-3-11-15(8)9/h1-3H,4-7H2 |
| InChIKey | BLLRPONTCYIJPM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone?
The IUPAC name of morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone (CID 12606981) is morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone.
What is the SMILES notation for morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone?
The canonical SMILES for morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone is O=C(c1nnc2cccnn12)N1CCOCC1.
What is the InChIKey of morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone?
The InChIKey is BLLRPONTCYIJPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O2/c16-10(14-4-6-17-7-5-14)9-13-12-8-2-1-3-11-15(8)9/h1-3H,4-7H2.
What are the key properties of morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone?
morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone has a molecular weight of 233.23 g/mol, XLogP of -0.40, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl([1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanone is sourced from PubChem (CID 12606981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).