C18H19BrN2O — CID 126075496
N-(2-bromophenyl)-1-(2-methyl-4-morpholin-4-ylphenyl)methanimine (PubChem CID 126075496) has the molecular formula C18H19BrN2O and a molecular weight of 359.27 g/mol. Its IUPAC name is N-(2-bromophenyl)-1-(2-methyl-4-morpholin-4-ylphenyl)methanimine.
| Compound Name | N-(2-bromophenyl)-1-(2-methyl-4-morpholin-4-ylphenyl)methanimine |
|---|---|
| PubChem CID | 126075496 |
| Molecular Formula | C18H19BrN2O |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-(2-bromophenyl)-1-(2-methyl-4-morpholin-4-ylphenyl)methanimine |
| SMILES | Cc1cc(N2CCOCC2)ccc1/C=N/c1ccccc1Br |
| InChI | InChI=1S/C18H19BrN2O/c1-14-12-16(21-8-10-22-11-9-21)7-6-15(14)13-20-18-5-3-2-4-17(18)19/h2-7,12-13H,8-11H2,1H3/b20-13+ |
| InChIKey | WHVQDXJJYZNZGN-DEDYPNTBSA-N |
| XLogP | 4.34 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|