C21H36N2O6-2 — CID 12607630
bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) propanedioate (PubChem CID 12607630) has the molecular formula C21H36N2O6-2 and a molecular weight of 412.53 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) propanedioate.
| Compound Name | bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) propanedioate |
|---|---|
| PubChem CID | 12607630 |
| Molecular Formula | C21H36N2O6-2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) propanedioate |
| SMILES | CC1(C)CC(OC(=O)CC(=O)OC2CC(C)(C)N([O-])C(C)(C)C2)CC(C)(C)N1[O-] |
| InChI | InChI=1S/C21H36N2O6/c1-18(2)10-14(11-19(3,4)22(18)26)28-16(24)9-17(25)29-15-12-20(5,6)23(27)21(7,8)13-15/h14-15H,9-13H2,1-8H3/q-2 |
| InChIKey | XGOFKMKWIOPWSG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|