C21H17ClINO5S — CID 126076416
methyl (2R)-2-[(5E)-5-[[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126076416) has the molecular formula C21H17ClINO5S and a molecular weight of 557.79 g/mol. Its IUPAC name is methyl (2R)-2-[(5E)-5-[[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[(5E)-5-[[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126076416 |
| Molecular Formula | C21H17ClINO5S |
| Molecular Weight | 557.79 g/mol |
| Exact Mass | 556.96 |
| IUPAC Name | methyl (2R)-2-[(5E)-5-[[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)N1C(=O)S/C(=C/c2ccc(OCc3ccc(Cl)cc3)c(I)c2)C1=O |
| InChI | InChI=1S/C21H17ClINO5S/c1-12(20(26)28-2)24-19(25)18(30-21(24)27)10-14-5-8-17(16(23)9-14)29-11-13-3-6-15(22)7-4-13/h3-10,12H,11H2,1-2H3/b18-10+/t12-/m1/s1 |
| InChIKey | MRSHDBFSIGWIBS-SGEFVQMOSA-N |
| XLogP | 5.12 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|