C10H15Cl3O2 — CID 12607839
cis-ethyl (1R,3R)-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate (PubChem CID 12607839) has the molecular formula C10H15Cl3O2 and a molecular weight of 273.59 g/mol. Its IUPAC name is cis-ethyl (1R,3R)-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,3R)-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 12607839 |
| Molecular Formula | C10H15Cl3O2 |
| Molecular Weight | 273.59 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | cis-ethyl (1R,3R)-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](CC(Cl)(Cl)Cl)C1(C)C |
| InChI | InChI=1S/C10H15Cl3O2/c1-4-15-8(14)7-6(9(7,2)3)5-10(11,12)13/h6-7H,4-5H2,1-3H3/t6-,7+/m1/s1 |
| InChIKey | BFRKWUSVYDWEBX-RQJHMYQMSA-N |
| XLogP | 3.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|