C23H15Cl3N2O4S — CID 126079026
[2,6-dichloro-4-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126079026) has the molecular formula C23H15Cl3N2O4S and a molecular weight of 521.81 g/mol. Its IUPAC name is [2,6-dichloro-4-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2,6-dichloro-4-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126079026 |
| Molecular Formula | C23H15Cl3N2O4S |
| Molecular Weight | 521.81 g/mol |
| Exact Mass | 519.98 |
| IUPAC Name | [2,6-dichloro-4-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C/c1cc(Cl)c(OS(=O)(=O)c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C23H15Cl3N2O4S/c1-14-4-2-3-5-21(14)28-23(29)16(13-27)10-15-11-19(25)22(20(26)12-15)32-33(30,31)18-8-6-17(24)7-9-18/h2-12H,1H3,(H,28,29)/b16-10+ |
| InChIKey | KEDKSMIMVJKIHN-MHWRWJLKSA-N |
| XLogP | 6.27 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.81 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|