About 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole
5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole (PubChem CID 1260803) has the molecular formula C18H19FN4O2S
and a molecular weight of 374.44 g/mol. Its IUPAC name is 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole.
Molecular Properties
| Compound Name | 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole |
| PubChem CID | 1260803 |
| Molecular Formula | C18H19FN4O2S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole |
| SMILES | CCOc1ccc(CSc2nnnn2-c2ccccc2F)cc1OCC |
| InChI | InChI=1S/C18H19FN4O2S/c1-3-24-16-10-9-13(11-17(16)25-4-2)12-26-18-20-21-22-23(18)15-8-6-5-7-14(15)19/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | AWBIFJWDKZTAIG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole?
The IUPAC name of 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole (CID 1260803) is 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole.
What is the SMILES notation for 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole?
The canonical SMILES for 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole is CCOc1ccc(CSc2nnnn2-c2ccccc2F)cc1OCC.
What is the InChIKey of 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole?
The InChIKey is AWBIFJWDKZTAIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN4O2S/c1-3-24-16-10-9-13(11-17(16)25-4-2)12-26-18-20-21-22-23(18)15-8-6-5-7-14(15)19/h5-11H,3-4,12H2,1-2H3.
What are the key properties of 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole?
5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole has a molecular weight of 374.44 g/mol, XLogP of 3.89, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-diethoxyphenyl)methylsulfanyl]-1-(2-fluorophenyl)tetrazole is sourced from PubChem (CID 1260803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).