C20H22N2S — CID 126083638
(6R)-2-(benzylideneamino)-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 126083638) has the molecular formula C20H22N2S and a molecular weight of 322.48 g/mol. Its IUPAC name is (6R)-2-(benzylideneamino)-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6R)-2-(benzylideneamino)-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126083638 |
| Molecular Formula | C20H22N2S |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (6R)-2-(benzylideneamino)-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(N=Cc3ccccc3)c2C#N)C1 |
| InChI | InChI=1S/C20H22N2S/c1-20(2,3)15-9-10-16-17(12-21)19(23-18(16)11-15)22-13-14-7-5-4-6-8-14/h4-8,13,15H,9-11H2,1-3H3/t15-/m1/s1 |
| InChIKey | DKDYLVVIGBQENB-OAHLLOKOSA-N |
| XLogP | 5.52 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|