C29H30BrClN2O2S — CID 126085071
(6R)-2-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-6-tert-butyl-N-(4-chlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126085071) has the molecular formula C29H30BrClN2O2S and a molecular weight of 586.00 g/mol. Its IUPAC name is (6R)-2-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-6-tert-butyl-N-(4-chlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-2-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-6-tert-butyl-N-(4-chlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126085071 |
| Molecular Formula | C29H30BrClN2O2S |
| Molecular Weight | 586.00 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | (6R)-2-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-6-tert-butyl-N-(4-chlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCOc1ccc(Br)cc1C=Nc1sc2c(c1C(=O)Nc1ccc(Cl)cc1)CC[C@@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C29H30BrClN2O2S/c1-5-14-35-24-13-7-20(30)15-18(24)17-32-28-26(27(34)33-22-10-8-21(31)9-11-22)23-12-6-19(29(2,3)4)16-25(23)36-28/h5,7-11,13,15,17,19H,1,6,12,14,16H2,2-4H3,(H,33,34)/t19-/m1/s1 |
| InChIKey | HYLCCOCYAPSLJS-LJQANCHMSA-N |
| XLogP | 8.88 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.00 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|