C19H22BrClN2O4S — CID 126085750
2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-(3-methoxypropyl)acetamide (PubChem CID 126085750) has the molecular formula C19H22BrClN2O4S and a molecular weight of 489.82 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 126085750 |
| Molecular Formula | C19H22BrClN2O4S |
| Molecular Weight | 489.82 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(Cc1ccc(Cl)cc1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H22BrClN2O4S/c1-27-12-2-11-22-19(24)14-23(13-15-3-7-17(21)8-4-15)28(25,26)18-9-5-16(20)6-10-18/h3-10H,2,11-14H2,1H3,(H,22,24) |
| InChIKey | BAJGOEUNUSQTKH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.82 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|