C24H23BrN2O4S — CID 126090029
N-(3-acetylphenyl)-2-[(4-bromophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]acetamide (PubChem CID 126090029) has the molecular formula C24H23BrN2O4S and a molecular weight of 515.43 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[(4-bromophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[(4-bromophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 126090029 |
| Molecular Formula | C24H23BrN2O4S |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | N-(3-acetylphenyl)-2-[(4-bromophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CN(Cc2ccc(C)cc2)S(=O)(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C24H23BrN2O4S/c1-17-6-8-19(9-7-17)15-27(32(30,31)23-12-10-21(25)11-13-23)16-24(29)26-22-5-3-4-20(14-22)18(2)28/h3-14H,15-16H2,1-2H3,(H,26,29) |
| InChIKey | VYHIVYDUDGFCOP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |