C32H23N3O8S — CID 126090114
2-[5-[(E)-[(5S)-6-ethoxycarbonyl-7-methyl-5-naphthalen-1-yl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]furan-2-yl]-5-nitrobenzoic acid (PubChem CID 126090114) has the molecular formula C32H23N3O8S and a molecular weight of 609.62 g/mol. Its IUPAC name is 2-[5-[(E)-[(5S)-6-ethoxycarbonyl-7-methyl-5-naphthalen-1-yl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]furan-2-yl]-5-nitrobenzoic acid.
| Compound Name | 2-[5-[(E)-[(5S)-6-ethoxycarbonyl-7-methyl-5-naphthalen-1-yl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]furan-2-yl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 126090114 |
| Molecular Formula | C32H23N3O8S |
| Molecular Weight | 609.62 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | 2-[5-[(E)-[(5S)-6-ethoxycarbonyl-7-methyl-5-naphthalen-1-yl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-2-ylidene]methyl]furan-2-yl]-5-nitrobenzoic acid |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3ccc(-c4ccc([N+](=O)[O-])cc4C(=O)O)o3)c(=O)n2[C@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C32H23N3O8S/c1-3-42-31(39)27-17(2)33-32-34(28(27)23-10-6-8-18-7-4-5-9-21(18)23)29(36)26(44-32)16-20-12-14-25(43-20)22-13-11-19(35(40)41)15-24(22)30(37)38/h4-16,28H,3H2,1-2H3,(H,37,38)/b26-16+/t28-/m0/s1 |
| InChIKey | ULRUMRLTFAGJPK-LCQSEVKBSA-N |
| XLogP | 4.82 |
| TPSA | 154.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|