C36H34Cl2N4O3S — CID 126092549
(2E,5R)-2-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-N,N-diethyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126092549) has the molecular formula C36H34Cl2N4O3S and a molecular weight of 673.67 g/mol. Its IUPAC name is (2E,5R)-2-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-N,N-diethyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5R)-2-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-N,N-diethyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126092549 |
| Molecular Formula | C36H34Cl2N4O3S |
| Molecular Weight | 673.67 g/mol |
| Exact Mass | 672.17 |
| IUPAC Name | (2E,5R)-2-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-N,N-diethyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C/c3cc(C)n(-c4ccc(Cl)c(Cl)c4)c3C)c(=O)n2[C@@H]1c1c(OC)ccc2ccccc12 |
| InChI | InChI=1S/C36H34Cl2N4O3S/c1-7-40(8-2)35(44)31-21(4)39-36-42(33(31)32-26-12-10-9-11-23(26)13-16-29(32)45-6)34(43)30(46-36)18-24-17-20(3)41(22(24)5)25-14-15-27(37)28(38)19-25/h9-19,33H,7-8H2,1-6H3/b30-18+/t33-/m0/s1 |
| InChIKey | GHYFYRTWCOAMBW-MQCBVOCZSA-N |
| XLogP | 6.98 |
| TPSA | 68.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|