C10HF15 — CID 12609525
1,2,3,4,5-pentakis(trifluoromethyl)cyclopenta-1,3-diene (PubChem CID 12609525) has the molecular formula C10HF15 and a molecular weight of 406.09 g/mol. Its IUPAC name is 1,2,3,4,5-pentakis(trifluoromethyl)cyclopenta-1,3-diene.
| Compound Name | 1,2,3,4,5-pentakis(trifluoromethyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 12609525 |
| Molecular Formula | C10HF15 |
| Molecular Weight | 406.09 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 1,2,3,4,5-pentakis(trifluoromethyl)cyclopenta-1,3-diene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C(C(F)(F)F)C(C(F)(F)F)=C1C(F)(F)F |
| InChI | InChI=1S/C10HF15/c11-6(12,13)1-2(7(14,15)16)4(9(20,21)22)5(10(23,24)25)3(1)8(17,18)19/h1H |
| InChIKey | JUXHETNKWVWTBW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.09 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |