C28H26BrN3O8S — CID 126095395
ethyl (2Z,5S)-5-(3-bromo-4-methoxyphenyl)-2-[(3-methoxy-5-nitro-2-prop-2-enoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126095395) has the molecular formula C28H26BrN3O8S and a molecular weight of 644.50 g/mol. Its IUPAC name is ethyl (2Z,5S)-5-(3-bromo-4-methoxyphenyl)-2-[(3-methoxy-5-nitro-2-prop-2-enoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5S)-5-(3-bromo-4-methoxyphenyl)-2-[(3-methoxy-5-nitro-2-prop-2-enoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126095395 |
| Molecular Formula | C28H26BrN3O8S |
| Molecular Weight | 644.50 g/mol |
| Exact Mass | 643.06 |
| IUPAC Name | ethyl (2Z,5S)-5-(3-bromo-4-methoxyphenyl)-2-[(3-methoxy-5-nitro-2-prop-2-enoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOc1c(/C=c2\sc3n(c2=O)[C@@H](c2ccc(OC)c(Br)c2)C(C(=O)OCC)=C(C)N=3)cc([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C28H26BrN3O8S/c1-6-10-40-25-17(11-18(32(35)36)14-21(25)38-5)13-22-26(33)31-24(16-8-9-20(37-4)19(29)12-16)23(27(34)39-7-2)15(3)30-28(31)41-22/h6,8-9,11-14,24H,1,7,10H2,2-5H3/b22-13-/t24-/m0/s1 |
| InChIKey | IGJODCGZEIGYDF-MFUBYVTQSA-N |
| XLogP | 4.05 |
| TPSA | 131.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|