C36H30IN3O7S — CID 126097104
ethyl (2E,5S)-2-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-7-methyl-5-naphthalen-1-yl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126097104) has the molecular formula C36H30IN3O7S and a molecular weight of 775.62 g/mol. Its IUPAC name is ethyl (2E,5S)-2-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-7-methyl-5-naphthalen-1-yl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5S)-2-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-7-methyl-5-naphthalen-1-yl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126097104 |
| Molecular Formula | C36H30IN3O7S |
| Molecular Weight | 775.62 g/mol |
| Exact Mass | 775.08 |
| IUPAC Name | ethyl (2E,5S)-2-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-7-methyl-5-naphthalen-1-yl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3cc(I)c(OCc4ccc([N+](=O)[O-])cc4)c(OCC)c3)c(=O)n2[C@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C36H30IN3O7S/c1-4-45-29-18-23(17-28(37)33(29)47-20-22-13-15-25(16-14-22)40(43)44)19-30-34(41)39-32(27-12-8-10-24-9-6-7-11-26(24)27)31(35(42)46-5-2)21(3)38-36(39)48-30/h6-19,32H,4-5,20H2,1-3H3/b30-19+/t32-/m0/s1 |
| InChIKey | PYRKTLJNEATVGQ-SAGCDJCOSA-N |
| XLogP | 6.44 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|