C22H22N2O7S — CID 126097412
(5E)-1-(2,4-dimethoxyphenyl)-2-sulfanylidene-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-diazinane-4,6-dione (PubChem CID 126097412) has the molecular formula C22H22N2O7S and a molecular weight of 458.49 g/mol. Its IUPAC name is (5E)-1-(2,4-dimethoxyphenyl)-2-sulfanylidene-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-(2,4-dimethoxyphenyl)-2-sulfanylidene-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126097412 |
| Molecular Formula | C22H22N2O7S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | (5E)-1-(2,4-dimethoxyphenyl)-2-sulfanylidene-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-diazinane-4,6-dione |
| SMILES | COc1ccc(N2C(=O)/C(=C/c3cc(OC)c(OC)cc3OC)C(=O)NC2=S)c(OC)c1 |
| InChI | InChI=1S/C22H22N2O7S/c1-27-13-6-7-15(17(10-13)29-3)24-21(26)14(20(25)23-22(24)32)8-12-9-18(30-4)19(31-5)11-16(12)28-2/h6-11H,1-5H3,(H,23,25,32)/b14-8+ |
| InChIKey | SPGFBROCMWQAPM-RIYZIHGNSA-N |
| XLogP | 2.56 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|