C25H21ClN2O3 — CID 126099124
(1S,2R,6R,7S,8R,10S)-4-[(Z)-[2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 126099124) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,10S)-4-[(Z)-[2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S,8R,10S)-4-[(Z)-[2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 126099124 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (1S,2R,6R,7S,8R,10S)-4-[(Z)-[2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@H]34)[C@H]2C(=O)N1/N=C\c1ccccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H21ClN2O3/c26-16-6-3-4-14(10-16)13-31-21-7-2-1-5-15(21)12-27-28-24(29)22-17-8-9-18(20-11-19(17)20)23(22)25(28)30/h1-10,12,17-20,22-23H,11,13H2/b27-12-/t17-,18-,19-,20+,22+,23+/m0/s1 |
| InChIKey | WMDWWJLBXSXZRX-DAVNMVFNSA-N |
| XLogP | 4.31 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|