C32H36IN3O2S — CID 126099624
(6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126099624) has the molecular formula C32H36IN3O2S and a molecular weight of 653.63 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126099624 |
| Molecular Formula | C32H36IN3O2S |
| Molecular Weight | 653.63 g/mol |
| Exact Mass | 653.16 |
| IUPAC Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(-n2c(C)cc(C=Nc3sc4c(c3C(=O)NCc3ccco3)CC[C@@H](C(C)(C)C)C4)c2C)cc1I |
| InChI | InChI=1S/C32H36IN3O2S/c1-19-9-11-24(16-27(19)33)36-20(2)14-22(21(36)3)17-35-31-29(30(37)34-18-25-8-7-13-38-25)26-12-10-23(32(4,5)6)15-28(26)39-31/h7-9,11,13-14,16-17,23H,10,12,15,18H2,1-6H3,(H,34,37)/t23-/m1/s1 |
| InChIKey | YLJKBTMSAIAAGR-HSZRJFAPSA-N |
| XLogP | 8.49 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.63 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|