C24H19ClN2OS — CID 126102160
(Z)-3-[4-(4-chlorophenyl)sulfanylphenyl]-2-cyano-N-(2-ethylphenyl)prop-2-enamide (PubChem CID 126102160) has the molecular formula C24H19ClN2OS and a molecular weight of 418.95 g/mol. Its IUPAC name is (Z)-3-[4-(4-chlorophenyl)sulfanylphenyl]-2-cyano-N-(2-ethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(4-chlorophenyl)sulfanylphenyl]-2-cyano-N-(2-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126102160 |
| Molecular Formula | C24H19ClN2OS |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (Z)-3-[4-(4-chlorophenyl)sulfanylphenyl]-2-cyano-N-(2-ethylphenyl)prop-2-enamide |
| SMILES | CCc1ccccc1NC(=O)/C(C#N)=C\c1ccc(Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H19ClN2OS/c1-2-18-5-3-4-6-23(18)27-24(28)19(16-26)15-17-7-11-21(12-8-17)29-22-13-9-20(25)10-14-22/h3-15H,2H2,1H3,(H,27,28)/b19-15- |
| InChIKey | DHNVWNCGCWMGBV-CYVLTUHYSA-N |
| XLogP | 6.60 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|