C23H18Cl2N4OS — CID 126104545
N-benzyl-2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 126104545) has the molecular formula C23H18Cl2N4OS and a molecular weight of 469.40 g/mol. Its IUPAC name is N-benzyl-2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-benzyl-2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 126104545 |
| Molecular Formula | C23H18Cl2N4OS |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | N-benzyl-2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C23H18Cl2N4OS/c24-18-8-6-17(7-9-18)22-27-28-23(29(22)20-12-10-19(25)11-13-20)31-15-21(30)26-14-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,26,30) |
| InChIKey | KGPWTIUWMRLTEG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |