C30H28N4O5S — CID 126106451
(2E,5S)-N,N-diethyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126106451) has the molecular formula C30H28N4O5S and a molecular weight of 556.64 g/mol. Its IUPAC name is (2E,5S)-N,N-diethyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5S)-N,N-diethyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126106451 |
| Molecular Formula | C30H28N4O5S |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | (2E,5S)-N,N-diethyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C/c3ccc([N+](=O)[O-])cc3)c(=O)n2[C@H]1c1c(OC)ccc2ccccc12 |
| InChI | InChI=1S/C30H28N4O5S/c1-5-32(6-2)29(36)25-18(3)31-30-33(27(25)26-22-10-8-7-9-20(22)13-16-23(26)39-4)28(35)24(40-30)17-19-11-14-21(15-12-19)34(37)38/h7-17,27H,5-6H2,1-4H3/b24-17+/t27-/m1/s1 |
| InChIKey | UVOXVCYUOXTZHH-QEYQTOMISA-N |
| XLogP | 4.17 |
| TPSA | 107.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|