C19H22ClF3N2O2 — CID 126106543
[(3R,3aS,5R)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(2-chlorophenyl)methanone (PubChem CID 126106543) has the molecular formula C19H22ClF3N2O2 and a molecular weight of 402.84 g/mol. Its IUPAC name is [(3R,3aS,5R)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(2-chlorophenyl)methanone.
| Compound Name | [(3R,3aS,5R)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(2-chlorophenyl)methanone |
|---|---|
| PubChem CID | 126106543 |
| Molecular Formula | C19H22ClF3N2O2 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [(3R,3aS,5R)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(2-chlorophenyl)methanone |
| SMILES | CC(C)(C)[C@@H]1CCC2=NN(C(=O)c3ccccc3Cl)[C@](O)(C(F)(F)F)[C@H]2C1 |
| InChI | InChI=1S/C19H22ClF3N2O2/c1-17(2,3)11-8-9-15-13(10-11)18(27,19(21,22)23)25(24-15)16(26)12-6-4-5-7-14(12)20/h4-7,11,13,27H,8-10H2,1-3H3/t11-,13+,18-/m1/s1 |
| InChIKey | ULEYWXZFJATTEP-SUFBMKPHSA-N |
| XLogP | 4.87 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |